![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 1. Faithless - Insom..> | 2024-06-25 19:45 | 8.6M | |
| 2. The Prodigy - Bre..> | 2024-06-25 19:45 | 9.5M | |
| 3. Underworld - Born..> | 2024-06-25 19:45 | 10M | |
| 4. The Chemical Brot..> | 2024-06-25 19:45 | 11M | |
| 5. Fatboy Slim - Pra..> | 2024-06-25 19:45 | 13M | |
| 6. Bomfunk MC's - Fr..> | 2024-06-25 19:45 | 6.9M | |
| 7. Leftfield - Phat ..> | 2024-06-25 19:45 | 12M | |
| 8. Armand Van Helden..> | 2024-06-25 19:45 | 7.5M | |
| 9. Mr.Oizo - Flat Be..> | 2024-06-25 19:46 | 9.3M | |
| 10. Deee-Lite - Groo..> | 2024-06-25 19:45 | 9.2M | |
| 11. Wildchild - Rene..> | 2024-06-25 19:45 | 14M | |
| 12. Babylon Zoo - Sp..> | 2024-06-25 19:45 | 9.4M | |
| 13. EMF - Unbelievab..> | 2024-06-25 19:45 | 8.4M | |
| 14. David Morales Fe..> | 2024-06-25 21:09 | 23M | |
| 15. Kenny 'Dope' Pre..> | 2024-06-25 19:45 | 8.1M | |
| 16. Ultra Naté - Fr..> | 2024-06-25 19:45 | 14M | |
| 17. Adamski, Seal - ..> | 2024-06-25 19:45 | 9.0M | |
| 18. The Age Of Love ..> | 2024-06-25 19:45 | 10M | |
| 19. N-Joi_Anthem [Th..> | 2024-06-25 19:45 | 9.5M | |
| 20. Opus III - It's ..> | 2024-06-25 19:45 | 9.0M | |