![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| FRONT.jpg | 2024-09-24 18:57 | 57K | |
| 19. Money.mp3 | 2024-09-24 19:07 | 17M | |
| 18. Negative Creep.mp3 | 2024-09-24 19:07 | 9.9M | |
| 17. No More, No More..> | 2024-09-24 19:07 | 13M | |
| 16. Surrender.mp3 | 2024-09-24 19:01 | 10M | |
| 15. Bodies (Live at..> | 2024-09-24 19:06 | 7.7M | |
| 14. Fall To Pieces ..> | 2024-09-24 19:06 | 9.6M | |
| 13. Loving The Alien..> | 2024-09-24 19:06 | 13M | |
| 12. Dirty Little Thi..> | 2024-09-24 19:06 | 9.1M | |
| 11. Slither.mp3 | 2024-09-24 19:06 | 9.5M | |
| 10. You Got No Right..> | 2024-09-24 19:06 | 13M | |
| 09. Set Me Free.mp3 | 2024-09-24 19:05 | 9.5M | |
| 08. Superhuman.mp3 | 2024-09-24 19:06 | 9.8M | |
| 07. Headspace.mp3 | 2024-09-24 19:05 | 8.6M | |
| 06. Fall to Pieces.mp3 | 2024-09-24 19:05 | 10M | |
| 05. Spectacle.mp3 | 2024-09-24 19:07 | 8.5M | |
| 04. Illegal i Song.mp3 | 2024-09-24 19:01 | 9.9M | |
| 03. Big Machine.mp3 | 2024-09-24 19:05 | 10M | |
| 02. Do It For The Ki..> | 2024-09-24 19:05 | 9.0M | |
| 01. Sucker Train Blu..> | 2024-09-24 19:07 | 10M | |